C24H24F2N2O2 — CID 20970512
2-(2,4-difluorophenyl)-N-(4-ethylcyclohexyl)-1-oxoisoquinoline-4-carboxamide (PubChem CID 20970512) has the molecular formula C24H24F2N2O2 and a molecular weight of 410.46 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-N-(4-ethylcyclohexyl)-1-oxoisoquinoline-4-carboxamide.
| Compound Name | 2-(2,4-difluorophenyl)-N-(4-ethylcyclohexyl)-1-oxoisoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 20970512 |
| Molecular Formula | C24H24F2N2O2 |
| Molecular Weight | 410.46 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 2-(2,4-difluorophenyl)-N-(4-ethylcyclohexyl)-1-oxoisoquinoline-4-carboxamide |
| SMILES | CCC1CCC(NC(=O)c2cn(-c3ccc(F)cc3F)c(=O)c3ccccc23)CC1 |
| InChI | InChI=1S/C24H24F2N2O2/c1-2-15-7-10-17(11-8-15)27-23(29)20-14-28(22-12-9-16(25)13-21(22)26)24(30)19-6-4-3-5-18(19)20/h3-6,9,12-15,17H,2,7-8,10-11H2,1H3,(H,27,29) |
| InChIKey | BUZSDMGTWUBRHQ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.46 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |