C25H28N2O2 — CID 4571848
N-cycloheptyl-2-(3,4-dimethylphenyl)-1-oxoisoquinoline-4-carboxamide (PubChem CID 4571848) has the molecular formula C25H28N2O2 and a molecular weight of 388.51 g/mol. Its IUPAC name is N-cycloheptyl-2-(3,4-dimethylphenyl)-1-oxoisoquinoline-4-carboxamide.
| Compound Name | N-cycloheptyl-2-(3,4-dimethylphenyl)-1-oxoisoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 4571848 |
| Molecular Formula | C25H28N2O2 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | N-cycloheptyl-2-(3,4-dimethylphenyl)-1-oxoisoquinoline-4-carboxamide |
| SMILES | Cc1ccc(-n2cc(C(=O)NC3CCCCCC3)c3ccccc3c2=O)cc1C |
| InChI | InChI=1S/C25H28N2O2/c1-17-13-14-20(15-18(17)2)27-16-23(21-11-7-8-12-22(21)25(27)29)24(28)26-19-9-5-3-4-6-10-19/h7-8,11-16,19H,3-6,9-10H2,1-2H3,(H,26,28) |
| InChIKey | RESDQAQALMIJDH-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |