C17H15N5O2S — CID 2097090
4-[[2-[(4-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]benzamide (PubChem CID 2097090) has the molecular formula C17H15N5O2S and a molecular weight of 353.41 g/mol. Its IUPAC name is 4-[[2-[(4-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]benzamide.
| Compound Name | 4-[[2-[(4-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 2097090 |
| Molecular Formula | C17H15N5O2S |
| Molecular Weight | 353.41 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | 4-[[2-[(4-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]benzamide |
| SMILES | NC(=O)c1ccc(NC(=O)CSc2nncn2-c2ccccc2)cc1 |
| InChI | InChI=1S/C17H15N5O2S/c18-16(24)12-6-8-13(9-7-12)20-15(23)10-25-17-21-19-11-22(17)14-4-2-1-3-5-14/h1-9,11H,10H2,(H2,18,24)(H,20,23) |
| InChIKey | IFARSHLNVNXURS-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.41 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |