C19H28N2O4 — CID 2097235
3,4-diethoxy-N-[2-(4-methylpiperidin-1-yl)-2-oxoethyl]benzamide (PubChem CID 2097235) has the molecular formula C19H28N2O4 and a molecular weight of 348.44 g/mol. Its IUPAC name is 3,4-diethoxy-N-[2-(4-methylpiperidin-1-yl)-2-oxoethyl]benzamide.
| Compound Name | 3,4-diethoxy-N-[2-(4-methylpiperidin-1-yl)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 2097235 |
| Molecular Formula | C19H28N2O4 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 3,4-diethoxy-N-[2-(4-methylpiperidin-1-yl)-2-oxoethyl]benzamide |
| SMILES | CCOc1ccc(C(=O)NCC(=O)N2CCC(C)CC2)cc1OCC |
| InChI | InChI=1S/C19H28N2O4/c1-4-24-16-7-6-15(12-17(16)25-5-2)19(23)20-13-18(22)21-10-8-14(3)9-11-21/h6-7,12,14H,4-5,8-11,13H2,1-3H3,(H,20,23) |
| InChIKey | MAZHOWVGBOYUMN-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |