C20H29N3O4 — CID 20972958
1-[4-(butanoylamino)benzoyl]-N-(2-methoxyethyl)piperidine-4-carboxamide (PubChem CID 20972958) has the molecular formula C20H29N3O4 and a molecular weight of 375.47 g/mol. Its IUPAC name is 1-[4-(butanoylamino)benzoyl]-N-(2-methoxyethyl)piperidine-4-carboxamide.
| Compound Name | 1-[4-(butanoylamino)benzoyl]-N-(2-methoxyethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 20972958 |
| Molecular Formula | C20H29N3O4 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | 1-[4-(butanoylamino)benzoyl]-N-(2-methoxyethyl)piperidine-4-carboxamide |
| SMILES | CCCC(=O)Nc1ccc(C(=O)N2CCC(C(=O)NCCOC)CC2)cc1 |
| InChI | InChI=1S/C20H29N3O4/c1-3-4-18(24)22-17-7-5-16(6-8-17)20(26)23-12-9-15(10-13-23)19(25)21-11-14-27-2/h5-8,15H,3-4,9-14H2,1-2H3,(H,21,25)(H,22,24) |
| InChIKey | ZZMHXTDMGXKCBG-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|