C26H35N2O6- — CID 20975902
2-hydroxy-2-oxoacetate;N-(2-morpholin-4-ylethyl)-2-(naphthalen-1-ylmethyl)-3-(oxolan-2-yl)propan-1-amine (PubChem CID 20975902) has the molecular formula C26H35N2O6- and a molecular weight of 471.57 g/mol. Its IUPAC name is 2-hydroxy-2-oxoacetate;N-(2-morpholin-4-ylethyl)-2-(naphthalen-1-ylmethyl)-3-(oxolan-2-yl)propan-1-amine.
| Compound Name | 2-hydroxy-2-oxoacetate;N-(2-morpholin-4-ylethyl)-2-(naphthalen-1-ylmethyl)-3-(oxolan-2-yl)propan-1-amine |
|---|---|
| PubChem CID | 20975902 |
| Molecular Formula | C26H35N2O6- |
| Molecular Weight | 471.57 g/mol |
| Exact Mass | 471.25 |
| IUPAC Name | 2-hydroxy-2-oxoacetate;N-(2-morpholin-4-ylethyl)-2-(naphthalen-1-ylmethyl)-3-(oxolan-2-yl)propan-1-amine |
| SMILES | O=C([O-])C(=O)O.c1ccc2c(CC(CNCCN3CCOCC3)CC3CCCO3)cccc2c1 |
| InChI | InChI=1S/C24H34N2O2.C2H2O4/c1-2-9-24-21(5-1)6-3-7-22(24)17-20(18-23-8-4-14-28-23)19-25-10-11-26-12-15-27-16-13-26;3-1(4)2(5)6/h1-3,5-7,9,20,23,25H,4,8,10-19H2;(H,3,4)(H,5,6)/p-1 |
| InChIKey | PJKVTZKSBGXCPP-UHFFFAOYSA-M |
| XLogP | 1.31 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.57 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|