C22H30NO3+ — CID 5113288
dimethyl-[2-[2-(naphthalen-1-ylmethyl)-3-(oxolan-2-yl)propanoyl]oxyethyl]azanium (PubChem CID 5113288) has the molecular formula C22H30NO3+ and a molecular weight of 356.49 g/mol. Its IUPAC name is dimethyl-[2-[2-(naphthalen-1-ylmethyl)-3-(oxolan-2-yl)propanoyl]oxyethyl]azanium.
| Compound Name | dimethyl-[2-[2-(naphthalen-1-ylmethyl)-3-(oxolan-2-yl)propanoyl]oxyethyl]azanium |
|---|---|
| PubChem CID | 5113288 |
| Molecular Formula | C22H30NO3+ |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | dimethyl-[2-[2-(naphthalen-1-ylmethyl)-3-(oxolan-2-yl)propanoyl]oxyethyl]azanium |
| SMILES | C[NH+](C)CCOC(=O)C(Cc1cccc2ccccc12)CC1CCCO1 |
| InChI | InChI=1S/C22H29NO3/c1-23(2)12-14-26-22(24)19(16-20-10-6-13-25-20)15-18-9-5-8-17-7-3-4-11-21(17)18/h3-5,7-9,11,19-20H,6,10,12-16H2,1-2H3/p+1 |
| InChIKey | WPQOOWXLKSEHBY-UHFFFAOYSA-O |
| XLogP | 2.26 |
| TPSA | 39.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |