C23H33NO3 — CID 102268179
2-(diethylamino)ethyl 2-(3H-inden-1-ylmethyl)-3-(oxolan-2-yl)propanoate (PubChem CID 102268179) has the molecular formula C23H33NO3 and a molecular weight of 371.52 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 2-(3H-inden-1-ylmethyl)-3-(oxolan-2-yl)propanoate.
| Compound Name | 2-(diethylamino)ethyl 2-(3H-inden-1-ylmethyl)-3-(oxolan-2-yl)propanoate |
|---|---|
| PubChem CID | 102268179 |
| Molecular Formula | C23H33NO3 |
| Molecular Weight | 371.52 g/mol |
| Exact Mass | 371.25 |
| IUPAC Name | 2-(diethylamino)ethyl 2-(3H-inden-1-ylmethyl)-3-(oxolan-2-yl)propanoate |
| SMILES | CCN(CC)CCOC(=O)C(CC1=CCc2ccccc21)CC1CCCO1 |
| InChI | InChI=1S/C23H33NO3/c1-3-24(4-2)13-15-27-23(25)20(17-21-9-7-14-26-21)16-19-12-11-18-8-5-6-10-22(18)19/h5-6,8,10,12,20-21H,3-4,7,9,11,13-17H2,1-2H3 |
| InChIKey | QETGRMYZRZNNKB-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.52 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |