C42H61N5O4 — CID 174805884
N',N'-dibutyl-N-(3-phenyl-1,2,4-oxadiazol-5-yl)ethane-1,2-diamine;2-(diethylamino)ethyl 2-(naphthalen-1-ylmethyl)-3-(oxolan-2-yl)propanoate (PubChem CID 174805884) has the molecular formula C42H61N5O4 and a molecular weight of 699.98 g/mol. Its IUPAC name is N',N'-dibutyl-N-(3-phenyl-1,2,4-oxadiazol-5-yl)ethane-1,2-diamine;2-(diethylamino)ethyl 2-(naphthalen-1-ylmethyl)-3-(oxolan-2-yl)propanoate.
| Compound Name | N',N'-dibutyl-N-(3-phenyl-1,2,4-oxadiazol-5-yl)ethane-1,2-diamine;2-(diethylamino)ethyl 2-(naphthalen-1-ylmethyl)-3-(oxolan-2-yl)propanoate |
|---|---|
| PubChem CID | 174805884 |
| Molecular Formula | C42H61N5O4 |
| Molecular Weight | 699.98 g/mol |
| Exact Mass | 699.47 |
| IUPAC Name | N',N'-dibutyl-N-(3-phenyl-1,2,4-oxadiazol-5-yl)ethane-1,2-diamine;2-(diethylamino)ethyl 2-(naphthalen-1-ylmethyl)-3-(oxolan-2-yl)propanoate |
| SMILES | CCCCN(CCCC)CCNc1nc(-c2ccccc2)no1.CCN(CC)CCOC(=O)C(Cc1cccc2ccccc12)CC1CCCO1 |
| InChI | InChI=1S/C24H33NO3.C18H28N4O/c1-3-25(4-2)14-16-28-24(26)21(18-22-12-8-15-27-22)17-20-11-7-10-19-9-5-6-13-23(19)20;1-3-5-13-22(14-6-4-2)15-12-19-18-20-17(21-23-18)16-10-8-7-9-11-16/h5-7,9-11,13,21-22H,3-4,8,12,14-18H2,1-2H3;7-11H,3-6,12-15H2,1-2H3,(H,19,20,21) |
| InChIKey | XXYJYQJAJFQUPU-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 92.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.98 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |