C15H19FO3 — CID 79417997
2-[(2-fluorophenyl)methyl]-3-(oxan-2-yl)propanoic acid (PubChem CID 79417997) has the molecular formula C15H19FO3 and a molecular weight of 266.31 g/mol. Its IUPAC name is 2-[(2-fluorophenyl)methyl]-3-(oxan-2-yl)propanoic acid.
| Compound Name | 2-[(2-fluorophenyl)methyl]-3-(oxan-2-yl)propanoic acid |
|---|---|
| PubChem CID | 79417997 |
| Molecular Formula | C15H19FO3 |
| Molecular Weight | 266.31 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 2-[(2-fluorophenyl)methyl]-3-(oxan-2-yl)propanoic acid |
| SMILES | O=C(O)C(Cc1ccccc1F)CC1CCCCO1 |
| InChI | InChI=1S/C15H19FO3/c16-14-7-2-1-5-11(14)9-12(15(17)18)10-13-6-3-4-8-19-13/h1-2,5,7,12-13H,3-4,6,8-10H2,(H,17,18) |
| InChIKey | NIYVVGZZGJHKQF-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.31 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |