C23H24N2O2 — CID 20976225
2-hydroxy-N-[2-(2-methylphenyl)ethyl]-2,2-diphenylacetohydrazide (PubChem CID 20976225) has the molecular formula C23H24N2O2 and a molecular weight of 360.46 g/mol. Its IUPAC name is 2-hydroxy-N-[2-(2-methylphenyl)ethyl]-2,2-diphenylacetohydrazide.
| Compound Name | 2-hydroxy-N-[2-(2-methylphenyl)ethyl]-2,2-diphenylacetohydrazide |
|---|---|
| PubChem CID | 20976225 |
| Molecular Formula | C23H24N2O2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 2-hydroxy-N-[2-(2-methylphenyl)ethyl]-2,2-diphenylacetohydrazide |
| SMILES | Cc1ccccc1CCN(N)C(=O)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H24N2O2/c1-18-10-8-9-11-19(18)16-17-25(24)22(26)23(27,20-12-4-2-5-13-20)21-14-6-3-7-15-21/h2-15,27H,16-17,24H2,1H3 |
| InChIKey | BPMJLOMHOCTBTE-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|