C16H24N4O4S-2 — CID 20976345
bis(1-phenylethylhydrazine);sulfate (PubChem CID 20976345) has the molecular formula C16H24N4O4S-2 and a molecular weight of 368.46 g/mol. Its IUPAC name is bis(1-phenylethylhydrazine);sulfate.
| Compound Name | bis(1-phenylethylhydrazine);sulfate |
|---|---|
| PubChem CID | 20976345 |
| Molecular Formula | C16H24N4O4S-2 |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | bis(1-phenylethylhydrazine);sulfate |
| SMILES | CC(NN)c1ccccc1.CC(NN)c1ccccc1.O=S(=O)([O-])[O-] |
| InChI | InChI=1S/2C8H12N2.H2O4S/c2*1-7(10-9)8-5-3-2-4-6-8;1-5(2,3)4/h2*2-7,10H,9H2,1H3;(H2,1,2,3,4)/p-2 |
| InChIKey | UXYQAHYNWDLGKM-UHFFFAOYSA-L |
| XLogP | 1.08 |
| TPSA | 156.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|