C11H14O3S2 — CID 20976466
3-[2-(disulfanyl)propyl]-4-methoxybenzoic acid (PubChem CID 20976466) has the molecular formula C11H14O3S2 and a molecular weight of 258.36 g/mol. Its IUPAC name is 3-[2-(disulfanyl)propyl]-4-methoxybenzoic acid.
| Compound Name | 3-[2-(disulfanyl)propyl]-4-methoxybenzoic acid |
|---|---|
| PubChem CID | 20976466 |
| Molecular Formula | C11H14O3S2 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | 3-[2-(disulfanyl)propyl]-4-methoxybenzoic acid |
| SMILES | COc1ccc(C(=O)O)cc1CC(C)SS |
| InChI | InChI=1S/C11H14O3S2/c1-7(16-15)5-9-6-8(11(12)13)3-4-10(9)14-2/h3-4,6-7,15H,5H2,1-2H3,(H,12,13) |
| InChIKey | RFWXPGHXNKJDID-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|