C29H31N3O2 — CID 20978010
2-(4-benzhydrylpiperazin-1-yl)-1-quinolin-2-yloxypropan-2-ol (PubChem CID 20978010) has the molecular formula C29H31N3O2 and a molecular weight of 453.59 g/mol. Its IUPAC name is 2-(4-benzhydrylpiperazin-1-yl)-1-quinolin-2-yloxypropan-2-ol.
| Compound Name | 2-(4-benzhydrylpiperazin-1-yl)-1-quinolin-2-yloxypropan-2-ol |
|---|---|
| PubChem CID | 20978010 |
| Molecular Formula | C29H31N3O2 |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.24 |
| IUPAC Name | 2-(4-benzhydrylpiperazin-1-yl)-1-quinolin-2-yloxypropan-2-ol |
| SMILES | CC(O)(COc1ccc2ccccc2n1)N1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C29H31N3O2/c1-29(33,22-34-27-17-16-23-10-8-9-15-26(23)30-27)32-20-18-31(19-21-32)28(24-11-4-2-5-12-24)25-13-6-3-7-14-25/h2-17,28,33H,18-22H2,1H3 |
| InChIKey | CMNTUZOCFMJLEW-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 48.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |