C21H21N3O2S3 — CID 2097848
2-(1,3-benzothiazol-2-ylmethylsulfanyl)-3-(2-methoxyethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 2097848) has the molecular formula C21H21N3O2S3 and a molecular weight of 443.62 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylmethylsulfanyl)-3-(2-methoxyethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 2-(1,3-benzothiazol-2-ylmethylsulfanyl)-3-(2-methoxyethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 2097848 |
| Molecular Formula | C21H21N3O2S3 |
| Molecular Weight | 443.62 g/mol |
| Exact Mass | 443.08 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylmethylsulfanyl)-3-(2-methoxyethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | COCCn1c(SCc2nc3ccccc3s2)nc2sc3c(c2c1=O)CCCC3 |
| InChI | InChI=1S/C21H21N3O2S3/c1-26-11-10-24-20(25)18-13-6-2-4-8-15(13)29-19(18)23-21(24)27-12-17-22-14-7-3-5-9-16(14)28-17/h3,5,7,9H,2,4,6,8,10-12H2,1H3 |
| InChIKey | CCEHLXLOUBOQKC-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.62 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |