C22H21ClN4O3S2 — CID 112773784
2-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methylsulfanyl]-3-(2-methoxyethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 112773784) has the molecular formula C22H21ClN4O3S2 and a molecular weight of 489.02 g/mol. Its IUPAC name is 2-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methylsulfanyl]-3-(2-methoxyethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methylsulfanyl]-3-(2-methoxyethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 112773784 |
| Molecular Formula | C22H21ClN4O3S2 |
| Molecular Weight | 489.02 g/mol |
| Exact Mass | 488.07 |
| IUPAC Name | 2-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methylsulfanyl]-3-(2-methoxyethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | COCCn1c(SCc2nnc(-c3ccccc3Cl)o2)nc2sc3c(c2c1=O)CCCC3 |
| InChI | InChI=1S/C22H21ClN4O3S2/c1-29-11-10-27-21(28)18-14-7-3-5-9-16(14)32-20(18)24-22(27)31-12-17-25-26-19(30-17)13-6-2-4-8-15(13)23/h2,4,6,8H,3,5,7,9-12H2,1H3 |
| InChIKey | YAKUJPCHJDKCQI-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 83.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.02 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |