C19H18N4O3S2 — CID 7876809
10-[[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]methylsulfanyl]-11-propyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one (PubChem CID 7876809) has the molecular formula C19H18N4O3S2 and a molecular weight of 414.51 g/mol. Its IUPAC name is 10-[[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]methylsulfanyl]-11-propyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one.
| Compound Name | 10-[[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]methylsulfanyl]-11-propyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one |
|---|---|
| PubChem CID | 7876809 |
| Molecular Formula | C19H18N4O3S2 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.08 |
| IUPAC Name | 10-[[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]methylsulfanyl]-11-propyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one |
| SMILES | CCCn1c(SCc2nnc(-c3ccco3)o2)nc2sc3c(c2c1=O)CCC3 |
| InChI | InChI=1S/C19H18N4O3S2/c1-2-8-23-18(24)15-11-5-3-7-13(11)28-17(15)20-19(23)27-10-14-21-22-16(26-14)12-6-4-9-25-12/h4,6,9H,2-3,5,7-8,10H2,1H3 |
| InChIKey | PGZNDKCXIRAPSR-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 86.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |