C29H35FN2O2S — CID 20978976
N-[3-(3-fluoro-4-methylphenyl)-5-(4-phenylpiperidin-1-yl)pentyl]benzenesulfonamide (PubChem CID 20978976) has the molecular formula C29H35FN2O2S and a molecular weight of 494.68 g/mol. Its IUPAC name is N-[3-(3-fluoro-4-methylphenyl)-5-(4-phenylpiperidin-1-yl)pentyl]benzenesulfonamide.
| Compound Name | N-[3-(3-fluoro-4-methylphenyl)-5-(4-phenylpiperidin-1-yl)pentyl]benzenesulfonamide |
|---|---|
| PubChem CID | 20978976 |
| Molecular Formula | C29H35FN2O2S |
| Molecular Weight | 494.68 g/mol |
| Exact Mass | 494.24 |
| IUPAC Name | N-[3-(3-fluoro-4-methylphenyl)-5-(4-phenylpiperidin-1-yl)pentyl]benzenesulfonamide |
| SMILES | Cc1ccc(C(CCNS(=O)(=O)c2ccccc2)CCN2CCC(c3ccccc3)CC2)cc1F |
| InChI | InChI=1S/C29H35FN2O2S/c1-23-12-13-27(22-29(23)30)25(14-18-31-35(33,34)28-10-6-3-7-11-28)15-19-32-20-16-26(17-21-32)24-8-4-2-5-9-24/h2-13,22,25-26,31H,14-21H2,1H3 |
| InChIKey | VPOCUQJIFVLXFH-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.68 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |