C17H24N2OS2 — CID 2097909
(7R)-7-tert-butyl-3-propyl-2-sulfanylidene-5,6,7,8-tetrahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 2097909) has the molecular formula C17H24N2OS2 and a molecular weight of 336.53 g/mol. Its IUPAC name is (7R)-7-tert-butyl-3-propyl-2-sulfanylidene-5,6,7,8-tetrahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | (7R)-7-tert-butyl-3-propyl-2-sulfanylidene-5,6,7,8-tetrahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 2097909 |
| Molecular Formula | C17H24N2OS2 |
| Molecular Weight | 336.53 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | (7R)-7-tert-butyl-3-propyl-2-sulfanylidene-5,6,7,8-tetrahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | CCCn1c(=S)[nH]c2sc3c(c2c1=O)CC[C@@H](C(C)(C)C)C3 |
| InChI | InChI=1S/C17H24N2OS2/c1-5-8-19-15(20)13-11-7-6-10(17(2,3)4)9-12(11)22-14(13)18-16(19)21/h10H,5-9H2,1-4H3,(H,18,21)/t10-/m1/s1 |
| InChIKey | MMUNBIZIULBPRB-SNVBAGLBSA-N |
| XLogP | 4.68 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.53 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|