C19H20N2OS2 — CID 3471855
7-methyl-3-(2-phenylethyl)-2-sulfanylidene-5,6,7,8-tetrahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 3471855) has the molecular formula C19H20N2OS2 and a molecular weight of 356.52 g/mol. Its IUPAC name is 7-methyl-3-(2-phenylethyl)-2-sulfanylidene-5,6,7,8-tetrahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 7-methyl-3-(2-phenylethyl)-2-sulfanylidene-5,6,7,8-tetrahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 3471855 |
| Molecular Formula | C19H20N2OS2 |
| Molecular Weight | 356.52 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | 7-methyl-3-(2-phenylethyl)-2-sulfanylidene-5,6,7,8-tetrahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | CC1CCc2c(sc3[nH]c(=S)n(CCc4ccccc4)c(=O)c23)C1 |
| InChI | InChI=1S/C19H20N2OS2/c1-12-7-8-14-15(11-12)24-17-16(14)18(22)21(19(23)20-17)10-9-13-5-3-2-4-6-13/h2-6,12H,7-11H2,1H3,(H,20,23) |
| InChIKey | ZGMDDXCAAKUXTC-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.52 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|