About N-ethylethanamine;2-methyl-4-[(2-methyl-4-pyridinyl)amino]phenol
N-ethylethanamine;2-methyl-4-[(2-methyl-4-pyridinyl)amino]phenol (PubChem CID 20979783) has the molecular formula C17H25N3O
and a molecular weight of 287.41 g/mol. Its IUPAC name is N-ethylethanamine;2-methyl-4-[(2-methyl-4-pyridinyl)amino]phenol.
Molecular Properties
| Compound Name | N-ethylethanamine;2-methyl-4-[(2-methyl-4-pyridinyl)amino]phenol |
| PubChem CID | 20979783 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | N-ethylethanamine;2-methyl-4-[(2-methyl-4-pyridinyl)amino]phenol |
| SMILES | CCNCC.Cc1cc(Nc2ccc(O)c(C)c2)ccn1 |
| InChI | InChI=1S/C13H14N2O.C4H11N/c1-9-7-11(3-4-13(9)16)15-12-5-6-14-10(2)8-12;1-3-5-4-2/h3-8,16H,1-2H3,(H,14,15);5H,3-4H2,1-2H3 |
| InChIKey | ISJMUJDZEJWCOJ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze N-ethylethanamine;2-methyl-4-[(2-methyl-4-pyridinyl)amino]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethylethanamine;2-methyl-4-[(2-methyl-4-pyridinyl)amino]phenol?
The IUPAC name of N-ethylethanamine;2-methyl-4-[(2-methyl-4-pyridinyl)amino]phenol (CID 20979783) is N-ethylethanamine;2-methyl-4-[(2-methyl-4-pyridinyl)amino]phenol.
What is the SMILES notation for N-ethylethanamine;2-methyl-4-[(2-methyl-4-pyridinyl)amino]phenol?
The canonical SMILES for N-ethylethanamine;2-methyl-4-[(2-methyl-4-pyridinyl)amino]phenol is CCNCC.Cc1cc(Nc2ccc(O)c(C)c2)ccn1.
What is the InChIKey of N-ethylethanamine;2-methyl-4-[(2-methyl-4-pyridinyl)amino]phenol?
The InChIKey is ISJMUJDZEJWCOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O.C4H11N/c1-9-7-11(3-4-13(9)16)15-12-5-6-14-10(2)8-12;1-3-5-4-2/h3-8,16H,1-2H3,(H,14,15);5H,3-4H2,1-2H3.
What are the key properties of N-ethylethanamine;2-methyl-4-[(2-methyl-4-pyridinyl)amino]phenol?
N-ethylethanamine;2-methyl-4-[(2-methyl-4-pyridinyl)amino]phenol has a molecular weight of 287.41 g/mol, XLogP of 3.76, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethylethanamine;2-methyl-4-[(2-methyl-4-pyridinyl)amino]phenol is sourced from PubChem (CID 20979783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).