C21H27NO10 — CID 20979867
3-(4-hydroxy-3-methoxyphenyl)prop-2-enoic acid;2-methyl-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybut-2-enenitrile (PubChem CID 20979867) has the molecular formula C21H27NO10 and a molecular weight of 453.44 g/mol. Its IUPAC name is 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoic acid;2-methyl-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybut-2-enenitrile.
| Compound Name | 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoic acid;2-methyl-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybut-2-enenitrile |
|---|---|
| PubChem CID | 20979867 |
| Molecular Formula | C21H27NO10 |
| Molecular Weight | 453.44 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoic acid;2-methyl-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybut-2-enenitrile |
| SMILES | CC(C#N)=CCOC1OC(CO)C(O)C(O)C1O.COc1cc(C=CC(=O)O)ccc1O |
| InChI | InChI=1S/C11H17NO6.C10H10O4/c1-6(4-12)2-3-17-11-10(16)9(15)8(14)7(5-13)18-11;1-14-9-6-7(2-4-8(9)11)3-5-10(12)13/h2,7-11,13-16H,3,5H2,1H3;2-6,11H,1H3,(H,12,13) |
| InChIKey | FIOZSVNAMCJLQO-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 189.93 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.44 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|