C20H23NO10 — CID 123407975
[2-cyano-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybut-2-enyl] 3-(3,4-dihydroxyphenyl)prop-2-enoate (PubChem CID 123407975) has the molecular formula C20H23NO10 and a molecular weight of 437.40 g/mol. Its IUPAC name is [2-cyano-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybut-2-enyl] 3-(3,4-dihydroxyphenyl)prop-2-enoate.
| Compound Name | [2-cyano-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybut-2-enyl] 3-(3,4-dihydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 123407975 |
| Molecular Formula | C20H23NO10 |
| Molecular Weight | 437.40 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | [2-cyano-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybut-2-enyl] 3-(3,4-dihydroxyphenyl)prop-2-enoate |
| SMILES | N#CC(=CCO[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)COC(=O)C=Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C20H23NO10/c21-8-12(5-6-29-20-19(28)18(27)17(26)15(9-22)31-20)10-30-16(25)4-2-11-1-3-13(23)14(24)7-11/h1-5,7,15,17-20,22-24,26-28H,6,9-10H2/t15-,17-,18+,19-,20-/m1/s1 |
| InChIKey | YZWOLRKFWACVBR-XIKSMUEASA-N |
| XLogP | -1.08 |
| TPSA | 189.93 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.40 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|