C20H23NO9 — CID 73157791
[2-cyano-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybut-2-enyl] 3-(4-hydroxyphenyl)prop-2-enoate (PubChem CID 73157791) has the molecular formula C20H23NO9 and a molecular weight of 421.40 g/mol. Its IUPAC name is [2-cyano-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybut-2-enyl] 3-(4-hydroxyphenyl)prop-2-enoate.
| Compound Name | [2-cyano-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybut-2-enyl] 3-(4-hydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 73157791 |
| Molecular Formula | C20H23NO9 |
| Molecular Weight | 421.40 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | [2-cyano-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybut-2-enyl] 3-(4-hydroxyphenyl)prop-2-enoate |
| SMILES | N#CC(=CCOC1OC(CO)C(O)C(O)C1O)COC(=O)C=Cc1ccc(O)cc1 |
| InChI | InChI=1S/C20H23NO9/c21-9-13(11-29-16(24)6-3-12-1-4-14(23)5-2-12)7-8-28-20-19(27)18(26)17(25)15(10-22)30-20/h1-7,15,17-20,22-23,25-27H,8,10-11H2 |
| InChIKey | CUXBICPZQSXIEU-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 169.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.40 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|