C18H25N3O — CID 20980021
2-(3,4,6,7-tetrahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-N-(2,4,6-trimethylphenyl)acetamide (PubChem CID 20980021) has the molecular formula C18H25N3O and a molecular weight of 299.42 g/mol. Its IUPAC name is 2-(3,4,6,7-tetrahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-N-(2,4,6-trimethylphenyl)acetamide.
| Compound Name | 2-(3,4,6,7-tetrahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-N-(2,4,6-trimethylphenyl)acetamide |
|---|---|
| PubChem CID | 20980021 |
| Molecular Formula | C18H25N3O |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.20 |
| IUPAC Name | 2-(3,4,6,7-tetrahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-N-(2,4,6-trimethylphenyl)acetamide |
| SMILES | Cc1cc(C)c(NC(=O)CN2CCN3CCC=C3C2)c(C)c1 |
| InChI | InChI=1S/C18H25N3O/c1-13-9-14(2)18(15(3)10-13)19-17(22)12-20-7-8-21-6-4-5-16(21)11-20/h5,9-10H,4,6-8,11-12H2,1-3H3,(H,19,22) |
| InChIKey | OFPRVIPCUJBDCV-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |