C15H14N3O2S- — CID 20981321
1-(1-methyl-1-oxido-1,2-benzothiazol-3-yl)-3-phenylurea (PubChem CID 20981321) has the molecular formula C15H14N3O2S- and a molecular weight of 300.36 g/mol. Its IUPAC name is 1-(1-methyl-1-oxido-1,2-benzothiazol-3-yl)-3-phenylurea.
| Compound Name | 1-(1-methyl-1-oxido-1,2-benzothiazol-3-yl)-3-phenylurea |
|---|---|
| PubChem CID | 20981321 |
| Molecular Formula | C15H14N3O2S- |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 1-(1-methyl-1-oxido-1,2-benzothiazol-3-yl)-3-phenylurea |
| SMILES | CS1([O-])N=C(NC(=O)Nc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C15H15N3O2S/c1-21(20)13-10-6-5-9-12(13)14(18-21)17-15(19)16-11-7-3-2-4-8-11/h2-10,20H,1H3,(H2,16,17,18,19)/p-1 |
| InChIKey | FDYKEOORRCUFBJ-UHFFFAOYSA-M |
| XLogP | 3.11 |
| TPSA | 76.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |