C12H11N3O2 — CID 20983356
5-amino-3-(3-ethoxyphenyl)-1,2-oxazole-4-carbonitrile (PubChem CID 20983356) has the molecular formula C12H11N3O2 and a molecular weight of 229.24 g/mol. Its IUPAC name is 5-amino-3-(3-ethoxyphenyl)-1,2-oxazole-4-carbonitrile.
| Compound Name | 5-amino-3-(3-ethoxyphenyl)-1,2-oxazole-4-carbonitrile |
|---|---|
| PubChem CID | 20983356 |
| Molecular Formula | C12H11N3O2 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 5-amino-3-(3-ethoxyphenyl)-1,2-oxazole-4-carbonitrile |
| SMILES | CCOc1cccc(-c2noc(N)c2C#N)c1 |
| InChI | InChI=1S/C12H11N3O2/c1-2-16-9-5-3-4-8(6-9)11-10(7-13)12(14)17-15-11/h3-6H,2,14H2,1H3 |
| InChIKey | XXSFOAUEPBRNPE-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 85.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |