C19H22ClNO3S — CID 20985944
3-chloro-5-methoxy-4-[2-(2-propan-2-ylphenoxy)ethoxy]benzenecarbothioamide (PubChem CID 20985944) has the molecular formula C19H22ClNO3S and a molecular weight of 379.91 g/mol. Its IUPAC name is 3-chloro-5-methoxy-4-[2-(2-propan-2-ylphenoxy)ethoxy]benzenecarbothioamide.
| Compound Name | 3-chloro-5-methoxy-4-[2-(2-propan-2-ylphenoxy)ethoxy]benzenecarbothioamide |
|---|---|
| PubChem CID | 20985944 |
| Molecular Formula | C19H22ClNO3S |
| Molecular Weight | 379.91 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | 3-chloro-5-methoxy-4-[2-(2-propan-2-ylphenoxy)ethoxy]benzenecarbothioamide |
| SMILES | COc1cc(C(N)=S)cc(Cl)c1OCCOc1ccccc1C(C)C |
| InChI | InChI=1S/C19H22ClNO3S/c1-12(2)14-6-4-5-7-16(14)23-8-9-24-18-15(20)10-13(19(21)25)11-17(18)22-3/h4-7,10-12H,8-9H2,1-3H3,(H2,21,25) |
| InChIKey | BEVCWYQQBDPWIK-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.91 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|