C23H26FNO4 — CID 20990188
2-[2-[3-[(4-fluorophenyl)methoxy]phenyl]ethylcarbamoyl]cyclohexane-1-carboxylic acid (PubChem CID 20990188) has the molecular formula C23H26FNO4 and a molecular weight of 399.46 g/mol. Its IUPAC name is 2-[2-[3-[(4-fluorophenyl)methoxy]phenyl]ethylcarbamoyl]cyclohexane-1-carboxylic acid.
| Compound Name | 2-[2-[3-[(4-fluorophenyl)methoxy]phenyl]ethylcarbamoyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 20990188 |
| Molecular Formula | C23H26FNO4 |
| Molecular Weight | 399.46 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | 2-[2-[3-[(4-fluorophenyl)methoxy]phenyl]ethylcarbamoyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCCCC1C(=O)NCCc1cccc(OCc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C23H26FNO4/c24-18-10-8-17(9-11-18)15-29-19-5-3-4-16(14-19)12-13-25-22(26)20-6-1-2-7-21(20)23(27)28/h3-5,8-11,14,20-21H,1-2,6-7,12-13,15H2,(H,25,26)(H,27,28) |
| InChIKey | XFSKOYRXGZDZCB-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.46 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |