C23H27NO4 — CID 20992942
2-[2-[4-(3-methylphenoxy)phenyl]ethylcarbamoyl]cyclohexane-1-carboxylic acid (PubChem CID 20992942) has the molecular formula C23H27NO4 and a molecular weight of 381.47 g/mol. Its IUPAC name is 2-[2-[4-(3-methylphenoxy)phenyl]ethylcarbamoyl]cyclohexane-1-carboxylic acid.
| Compound Name | 2-[2-[4-(3-methylphenoxy)phenyl]ethylcarbamoyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 20992942 |
| Molecular Formula | C23H27NO4 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | 2-[2-[4-(3-methylphenoxy)phenyl]ethylcarbamoyl]cyclohexane-1-carboxylic acid |
| SMILES | Cc1cccc(Oc2ccc(CCNC(=O)C3CCCCC3C(=O)O)cc2)c1 |
| InChI | InChI=1S/C23H27NO4/c1-16-5-4-6-19(15-16)28-18-11-9-17(10-12-18)13-14-24-22(25)20-7-2-3-8-21(20)23(26)27/h4-6,9-12,15,20-21H,2-3,7-8,13-14H2,1H3,(H,24,25)(H,26,27) |
| InChIKey | NXWWPQWTOTVUQN-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |