C23H28O5 — CID 20993694
3-[2-[2-(2-tert-butyl-6-methylphenoxy)ethoxy]-4-methoxyphenyl]prop-2-enoic acid (PubChem CID 20993694) has the molecular formula C23H28O5 and a molecular weight of 384.47 g/mol. Its IUPAC name is 3-[2-[2-(2-tert-butyl-6-methylphenoxy)ethoxy]-4-methoxyphenyl]prop-2-enoic acid.
| Compound Name | 3-[2-[2-(2-tert-butyl-6-methylphenoxy)ethoxy]-4-methoxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 20993694 |
| Molecular Formula | C23H28O5 |
| Molecular Weight | 384.47 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | 3-[2-[2-(2-tert-butyl-6-methylphenoxy)ethoxy]-4-methoxyphenyl]prop-2-enoic acid |
| SMILES | COc1ccc(C=CC(=O)O)c(OCCOc2c(C)cccc2C(C)(C)C)c1 |
| InChI | InChI=1S/C23H28O5/c1-16-7-6-8-19(23(2,3)4)22(16)28-14-13-27-20-15-18(26-5)11-9-17(20)10-12-21(24)25/h6-12,15H,13-14H2,1-5H3,(H,24,25) |
| InChIKey | OFYQSOCQPCRKOC-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.47 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|