C19H15N7O3S — CID 20994554
N-(4-nitrophenyl)-2-[(5-pyridin-2-yl-4-pyrrol-1-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide (PubChem CID 20994554) has the molecular formula C19H15N7O3S and a molecular weight of 421.44 g/mol. Its IUPAC name is N-(4-nitrophenyl)-2-[(5-pyridin-2-yl-4-pyrrol-1-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide.
| Compound Name | N-(4-nitrophenyl)-2-[(5-pyridin-2-yl-4-pyrrol-1-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 20994554 |
| Molecular Formula | C19H15N7O3S |
| Molecular Weight | 421.44 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | N-(4-nitrophenyl)-2-[(5-pyridin-2-yl-4-pyrrol-1-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
| SMILES | O=C(CSc1nnc(-c2ccccn2)n1-n1cccc1)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H15N7O3S/c27-17(21-14-6-8-15(9-7-14)26(28)29)13-30-19-23-22-18(16-5-1-2-10-20-16)25(19)24-11-3-4-12-24/h1-12H,13H2,(H,21,27) |
| InChIKey | NLSHKRLXPJEMCG-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.44 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|