C17H16N6O3S — CID 71005994
2-[[4-ethyl-5-(5-nitro-2-pyridinyl)-1,2,4-triazol-3-yl]sulfanyl]-N-phenylacetamide (PubChem CID 71005994) has the molecular formula C17H16N6O3S and a molecular weight of 384.42 g/mol. Its IUPAC name is 2-[[4-ethyl-5-(5-nitro-2-pyridinyl)-1,2,4-triazol-3-yl]sulfanyl]-N-phenylacetamide.
| Compound Name | 2-[[4-ethyl-5-(5-nitro-2-pyridinyl)-1,2,4-triazol-3-yl]sulfanyl]-N-phenylacetamide |
|---|---|
| PubChem CID | 71005994 |
| Molecular Formula | C17H16N6O3S |
| Molecular Weight | 384.42 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | 2-[[4-ethyl-5-(5-nitro-2-pyridinyl)-1,2,4-triazol-3-yl]sulfanyl]-N-phenylacetamide |
| SMILES | CCn1c(SCC(=O)Nc2ccccc2)nnc1-c1ccc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C17H16N6O3S/c1-2-22-16(14-9-8-13(10-18-14)23(25)26)20-21-17(22)27-11-15(24)19-12-6-4-3-5-7-12/h3-10H,2,11H2,1H3,(H,19,24) |
| InChIKey | RUABIEBKRFBTTG-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.42 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|