C10H9FN4O — CID 20995217
5-[(2-fluorophenyl)methylamino]-2H-1,2,4-triazin-3-one (PubChem CID 20995217) has the molecular formula C10H9FN4O and a molecular weight of 220.21 g/mol. Its IUPAC name is 5-[(2-fluorophenyl)methylamino]-2H-1,2,4-triazin-3-one.
| Compound Name | 5-[(2-fluorophenyl)methylamino]-2H-1,2,4-triazin-3-one |
|---|---|
| PubChem CID | 20995217 |
| Molecular Formula | C10H9FN4O |
| Molecular Weight | 220.21 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 5-[(2-fluorophenyl)methylamino]-2H-1,2,4-triazin-3-one |
| SMILES | O=c1nc(NCc2ccccc2F)cn[nH]1 |
| InChI | InChI=1S/C10H9FN4O/c11-8-4-2-1-3-7(8)5-12-9-6-13-15-10(16)14-9/h1-4,6H,5H2,(H2,12,14,15,16) |
| InChIKey | CQWITOCJFGUJBK-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.21 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |