C22H23N3O5S — CID 20997352
1-(1,1-dioxothiolan-3-yl)-N,5-bis(4-methoxyphenyl)pyrazole-3-carboxamide (PubChem CID 20997352) has the molecular formula C22H23N3O5S and a molecular weight of 441.51 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-N,5-bis(4-methoxyphenyl)pyrazole-3-carboxamide.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-N,5-bis(4-methoxyphenyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 20997352 |
| Molecular Formula | C22H23N3O5S |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-N,5-bis(4-methoxyphenyl)pyrazole-3-carboxamide |
| SMILES | COc1ccc(NC(=O)c2cc(-c3ccc(OC)cc3)n(C3CCS(=O)(=O)C3)n2)cc1 |
| InChI | InChI=1S/C22H23N3O5S/c1-29-18-7-3-15(4-8-18)21-13-20(24-25(21)17-11-12-31(27,28)14-17)22(26)23-16-5-9-19(30-2)10-6-16/h3-10,13,17H,11-12,14H2,1-2H3,(H,23,26) |
| InChIKey | JOUBNULDQWTOBW-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |