About 1-[(3S)-1,1-dioxothiolan-3-yl]-5-(4-methoxyphenyl)-N-prop-2-enylpyrazole-3-carboxamide
1-[(3S)-1,1-dioxothiolan-3-yl]-5-(4-methoxyphenyl)-N-prop-2-enylpyrazole-3-carboxamide (PubChem CID 42341803) has the molecular formula C18H21N3O4S
and a molecular weight of 375.45 g/mol. Its IUPAC name is 1-[(3S)-1,1-dioxothiolan-3-yl]-5-(4-methoxyphenyl)-N-prop-2-enylpyrazole-3-carboxamide.
Molecular Properties
| Compound Name | 1-[(3S)-1,1-dioxothiolan-3-yl]-5-(4-methoxyphenyl)-N-prop-2-enylpyrazole-3-carboxamide |
| PubChem CID | 42341803 |
| Molecular Formula | C18H21N3O4S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 1-[(3S)-1,1-dioxothiolan-3-yl]-5-(4-methoxyphenyl)-N-prop-2-enylpyrazole-3-carboxamide |
| SMILES | C=CCNC(=O)c1cc(-c2ccc(OC)cc2)n([C@H]2CCS(=O)(=O)C2)n1 |
| InChI | InChI=1S/C18H21N3O4S/c1-3-9-19-18(22)16-11-17(13-4-6-15(25-2)7-5-13)21(20-16)14-8-10-26(23,24)12-14/h3-7,11,14H,1,8-10,12H2,2H3,(H,19,22)/t14-/m0/s1 |
| InChIKey | YSBKUQQIYQAENF-AWEZNQCLSA-N |
| XLogP | 1.83 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(3S)-1,1-dioxothiolan-3-yl]-5-(4-methoxyphenyl)-N-prop-2-enylpyrazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3S)-1,1-dioxothiolan-3-yl]-5-(4-methoxyphenyl)-N-prop-2-enylpyrazole-3-carboxamide?
The IUPAC name of 1-[(3S)-1,1-dioxothiolan-3-yl]-5-(4-methoxyphenyl)-N-prop-2-enylpyrazole-3-carboxamide (CID 42341803) is 1-[(3S)-1,1-dioxothiolan-3-yl]-5-(4-methoxyphenyl)-N-prop-2-enylpyrazole-3-carboxamide.
What is the SMILES notation for 1-[(3S)-1,1-dioxothiolan-3-yl]-5-(4-methoxyphenyl)-N-prop-2-enylpyrazole-3-carboxamide?
The canonical SMILES for 1-[(3S)-1,1-dioxothiolan-3-yl]-5-(4-methoxyphenyl)-N-prop-2-enylpyrazole-3-carboxamide is C=CCNC(=O)c1cc(-c2ccc(OC)cc2)n([C@H]2CCS(=O)(=O)C2)n1.
What is the InChIKey of 1-[(3S)-1,1-dioxothiolan-3-yl]-5-(4-methoxyphenyl)-N-prop-2-enylpyrazole-3-carboxamide?
The InChIKey is YSBKUQQIYQAENF-AWEZNQCLSA-N. The full InChI is InChI=1S/C18H21N3O4S/c1-3-9-19-18(22)16-11-17(13-4-6-15(25-2)7-5-13)21(20-16)14-8-10-26(23,24)12-14/h3-7,11,14H,1,8-10,12H2,2H3,(H,19,22)/t14-/m0/s1.
What are the key properties of 1-[(3S)-1,1-dioxothiolan-3-yl]-5-(4-methoxyphenyl)-N-prop-2-enylpyrazole-3-carboxamide?
1-[(3S)-1,1-dioxothiolan-3-yl]-5-(4-methoxyphenyl)-N-prop-2-enylpyrazole-3-carboxamide has a molecular weight of 375.45 g/mol, XLogP of 1.83, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3S)-1,1-dioxothiolan-3-yl]-5-(4-methoxyphenyl)-N-prop-2-enylpyrazole-3-carboxamide is sourced from PubChem (CID 42341803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).