C15H20ClN3O — CID 20997997
4,6-dimethyl-N-(4-propoxyphenyl)pyrimidin-2-amine;hydrochloride (PubChem CID 20997997) has the molecular formula C15H20ClN3O and a molecular weight of 293.80 g/mol. Its IUPAC name is 4,6-dimethyl-N-(4-propoxyphenyl)pyrimidin-2-amine;hydrochloride.
| Compound Name | 4,6-dimethyl-N-(4-propoxyphenyl)pyrimidin-2-amine;hydrochloride |
|---|---|
| PubChem CID | 20997997 |
| Molecular Formula | C15H20ClN3O |
| Molecular Weight | 293.80 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | 4,6-dimethyl-N-(4-propoxyphenyl)pyrimidin-2-amine;hydrochloride |
| SMILES | CCCOc1ccc(Nc2nc(C)cc(C)n2)cc1.Cl |
| InChI | InChI=1S/C15H19N3O.ClH/c1-4-9-19-14-7-5-13(6-8-14)18-15-16-11(2)10-12(3)17-15;/h5-8,10H,4,9H2,1-3H3,(H,16,17,18);1H |
| InChIKey | RGRHMBVOWBWEIB-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.80 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |