C20H18ClN3OS — CID 21000054
1-[2-(4-chlorophenoxy)ethylsulfanyl]-5,9-dimethyl-[1,2,4]triazolo[4,3-a]quinoline (PubChem CID 21000054) has the molecular formula C20H18ClN3OS and a molecular weight of 383.90 g/mol. Its IUPAC name is 1-[2-(4-chlorophenoxy)ethylsulfanyl]-5,9-dimethyl-[1,2,4]triazolo[4,3-a]quinoline.
| Compound Name | 1-[2-(4-chlorophenoxy)ethylsulfanyl]-5,9-dimethyl-[1,2,4]triazolo[4,3-a]quinoline |
|---|---|
| PubChem CID | 21000054 |
| Molecular Formula | C20H18ClN3OS |
| Molecular Weight | 383.90 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | 1-[2-(4-chlorophenoxy)ethylsulfanyl]-5,9-dimethyl-[1,2,4]triazolo[4,3-a]quinoline |
| SMILES | Cc1cc2nnc(SCCOc3ccc(Cl)cc3)n2c2c(C)cccc12 |
| InChI | InChI=1S/C20H18ClN3OS/c1-13-4-3-5-17-14(2)12-18-22-23-20(24(18)19(13)17)26-11-10-25-16-8-6-15(21)7-9-16/h3-9,12H,10-11H2,1-2H3 |
| InChIKey | UJMVNDQHDOGLNV-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.90 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|