C23H20N4O2S — CID 22694003
2-[3-[(5,9-dimethyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]propyl]isoindole-1,3-dione (PubChem CID 22694003) has the molecular formula C23H20N4O2S and a molecular weight of 416.51 g/mol. Its IUPAC name is 2-[3-[(5,9-dimethyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]propyl]isoindole-1,3-dione.
| Compound Name | 2-[3-[(5,9-dimethyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 22694003 |
| Molecular Formula | C23H20N4O2S |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 2-[3-[(5,9-dimethyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]propyl]isoindole-1,3-dione |
| SMILES | Cc1cc2nnc(SCCCN3C(=O)c4ccccc4C3=O)n2c2c(C)cccc12 |
| InChI | InChI=1S/C23H20N4O2S/c1-14-7-5-10-16-15(2)13-19-24-25-23(27(19)20(14)16)30-12-6-11-26-21(28)17-8-3-4-9-18(17)22(26)29/h3-5,7-10,13H,6,11-12H2,1-2H3 |
| InChIKey | FBGDGMFZDLYHLA-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 67.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|