C19H13N3O2 — CID 21001889
4-[(3-cyano-5-phenyl-2-pyridinyl)amino]benzoic acid (PubChem CID 21001889) has the molecular formula C19H13N3O2 and a molecular weight of 315.33 g/mol. Its IUPAC name is 4-[(3-cyano-5-phenyl-2-pyridinyl)amino]benzoic acid.
| Compound Name | 4-[(3-cyano-5-phenyl-2-pyridinyl)amino]benzoic acid |
|---|---|
| PubChem CID | 21001889 |
| Molecular Formula | C19H13N3O2 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | 4-[(3-cyano-5-phenyl-2-pyridinyl)amino]benzoic acid |
| SMILES | N#Cc1cc(-c2ccccc2)cnc1Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C19H13N3O2/c20-11-15-10-16(13-4-2-1-3-5-13)12-21-18(15)22-17-8-6-14(7-9-17)19(23)24/h1-10,12H,(H,21,22)(H,23,24) |
| InChIKey | YPCARMYCUNZXAD-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 86.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |