C15H16N4O2S — CID 21002721
3-[2-[(6-ethylquinazolin-4-yl)amino]ethyl]-1,3-thiazolidine-2,4-dione (PubChem CID 21002721) has the molecular formula C15H16N4O2S and a molecular weight of 316.39 g/mol. Its IUPAC name is 3-[2-[(6-ethylquinazolin-4-yl)amino]ethyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-[2-[(6-ethylquinazolin-4-yl)amino]ethyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 21002721 |
| Molecular Formula | C15H16N4O2S |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 3-[2-[(6-ethylquinazolin-4-yl)amino]ethyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CCc1ccc2ncnc(NCCN3C(=O)CSC3=O)c2c1 |
| InChI | InChI=1S/C15H16N4O2S/c1-2-10-3-4-12-11(7-10)14(18-9-17-12)16-5-6-19-13(20)8-22-15(19)21/h3-4,7,9H,2,5-6,8H2,1H3,(H,16,17,18) |
| InChIKey | SBOGCZCOIUEKHQ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|