C13H10F3N3O4 — CID 21003236
2-[carboxymethyl-[2-(trifluoromethyl)quinazolin-4-yl]amino]acetic acid (PubChem CID 21003236) has the molecular formula C13H10F3N3O4 and a molecular weight of 329.23 g/mol. Its IUPAC name is 2-[carboxymethyl-[2-(trifluoromethyl)quinazolin-4-yl]amino]acetic acid.
| Compound Name | 2-[carboxymethyl-[2-(trifluoromethyl)quinazolin-4-yl]amino]acetic acid |
|---|---|
| PubChem CID | 21003236 |
| Molecular Formula | C13H10F3N3O4 |
| Molecular Weight | 329.23 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | 2-[carboxymethyl-[2-(trifluoromethyl)quinazolin-4-yl]amino]acetic acid |
| SMILES | O=C(O)CN(CC(=O)O)c1nc(C(F)(F)F)nc2ccccc12 |
| InChI | InChI=1S/C13H10F3N3O4/c14-13(15,16)12-17-8-4-2-1-3-7(8)11(18-12)19(5-9(20)21)6-10(22)23/h1-4H,5-6H2,(H,20,21)(H,22,23) |
| InChIKey | OCPZPDRZODSNSG-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 103.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.23 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |