C12H9F3N2O2S — CID 39787773
(2S)-2-[2-(trifluoromethyl)quinazolin-4-yl]sulfanylpropanoic acid (PubChem CID 39787773) has the molecular formula C12H9F3N2O2S and a molecular weight of 302.28 g/mol. Its IUPAC name is (2S)-2-[2-(trifluoromethyl)quinazolin-4-yl]sulfanylpropanoic acid.
| Compound Name | (2S)-2-[2-(trifluoromethyl)quinazolin-4-yl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 39787773 |
| Molecular Formula | C12H9F3N2O2S |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.03 |
| IUPAC Name | (2S)-2-[2-(trifluoromethyl)quinazolin-4-yl]sulfanylpropanoic acid |
| SMILES | C[C@H](Sc1nc(C(F)(F)F)nc2ccccc12)C(=O)O |
| InChI | InChI=1S/C12H9F3N2O2S/c1-6(10(18)19)20-9-7-4-2-3-5-8(7)16-11(17-9)12(13,14)15/h2-6H,1H3,(H,18,19)/t6-/m0/s1 |
| InChIKey | QYXXTFPNBVPVMX-LURJTMIESA-N |
| XLogP | 3.21 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |