C20H18F3N3O2S — CID 43015451
N-(4-ethoxyphenyl)-2-[2-(trifluoromethyl)quinazolin-4-yl]sulfanylpropanamide (PubChem CID 43015451) has the molecular formula C20H18F3N3O2S and a molecular weight of 421.44 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-2-[2-(trifluoromethyl)quinazolin-4-yl]sulfanylpropanamide.
| Compound Name | N-(4-ethoxyphenyl)-2-[2-(trifluoromethyl)quinazolin-4-yl]sulfanylpropanamide |
|---|---|
| PubChem CID | 43015451 |
| Molecular Formula | C20H18F3N3O2S |
| Molecular Weight | 421.44 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | N-(4-ethoxyphenyl)-2-[2-(trifluoromethyl)quinazolin-4-yl]sulfanylpropanamide |
| SMILES | CCOc1ccc(NC(=O)C(C)Sc2nc(C(F)(F)F)nc3ccccc23)cc1 |
| InChI | InChI=1S/C20H18F3N3O2S/c1-3-28-14-10-8-13(9-11-14)24-17(27)12(2)29-18-15-6-4-5-7-16(15)25-19(26-18)20(21,22)23/h4-12H,3H2,1-2H3,(H,24,27) |
| InChIKey | JNFOIPWGXAWELF-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.44 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |