C15H16F3N3O2S — CID 9308123
(2S)-N-(2-methoxyethyl)-2-[2-(trifluoromethyl)quinazolin-4-yl]sulfanylpropanamide (PubChem CID 9308123) has the molecular formula C15H16F3N3O2S and a molecular weight of 359.37 g/mol. Its IUPAC name is (2S)-N-(2-methoxyethyl)-2-[2-(trifluoromethyl)quinazolin-4-yl]sulfanylpropanamide.
| Compound Name | (2S)-N-(2-methoxyethyl)-2-[2-(trifluoromethyl)quinazolin-4-yl]sulfanylpropanamide |
|---|---|
| PubChem CID | 9308123 |
| Molecular Formula | C15H16F3N3O2S |
| Molecular Weight | 359.37 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | (2S)-N-(2-methoxyethyl)-2-[2-(trifluoromethyl)quinazolin-4-yl]sulfanylpropanamide |
| SMILES | COCCNC(=O)[C@H](C)Sc1nc(C(F)(F)F)nc2ccccc12 |
| InChI | InChI=1S/C15H16F3N3O2S/c1-9(12(22)19-7-8-23-2)24-13-10-5-3-4-6-11(10)20-14(21-13)15(16,17)18/h3-6,9H,7-8H2,1-2H3,(H,19,22)/t9-/m0/s1 |
| InChIKey | UDQMEFTYBWRUDE-VIFPVBQESA-N |
| XLogP | 2.89 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.37 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|