C17H13F3N2O3S — CID 39067872
methyl 5-[(1S)-1-[2-(trifluoromethyl)quinazolin-4-yl]sulfanylethyl]furan-2-carboxylate (PubChem CID 39067872) has the molecular formula C17H13F3N2O3S and a molecular weight of 382.36 g/mol. Its IUPAC name is methyl 5-[(1S)-1-[2-(trifluoromethyl)quinazolin-4-yl]sulfanylethyl]furan-2-carboxylate.
| Compound Name | methyl 5-[(1S)-1-[2-(trifluoromethyl)quinazolin-4-yl]sulfanylethyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 39067872 |
| Molecular Formula | C17H13F3N2O3S |
| Molecular Weight | 382.36 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | methyl 5-[(1S)-1-[2-(trifluoromethyl)quinazolin-4-yl]sulfanylethyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc([C@H](C)Sc2nc(C(F)(F)F)nc3ccccc23)o1 |
| InChI | InChI=1S/C17H13F3N2O3S/c1-9(12-7-8-13(25-12)15(23)24-2)26-14-10-5-3-4-6-11(10)21-16(22-14)17(18,19)20/h3-9H,1-2H3/t9-/m0/s1 |
| InChIKey | HRSLIHSARVMIBB-VIFPVBQESA-N |
| XLogP | 4.88 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.36 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |