C15H11F3N2OS — CID 21003666
4-(furan-2-ylmethylsulfanyl)-6-methyl-2-(trifluoromethyl)quinazoline (PubChem CID 21003666) has the molecular formula C15H11F3N2OS and a molecular weight of 324.33 g/mol. Its IUPAC name is 4-(furan-2-ylmethylsulfanyl)-6-methyl-2-(trifluoromethyl)quinazoline.
| Compound Name | 4-(furan-2-ylmethylsulfanyl)-6-methyl-2-(trifluoromethyl)quinazoline |
|---|---|
| PubChem CID | 21003666 |
| Molecular Formula | C15H11F3N2OS |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | 4-(furan-2-ylmethylsulfanyl)-6-methyl-2-(trifluoromethyl)quinazoline |
| SMILES | Cc1ccc2nc(C(F)(F)F)nc(SCc3ccco3)c2c1 |
| InChI | InChI=1S/C15H11F3N2OS/c1-9-4-5-12-11(7-9)13(20-14(19-12)15(16,17)18)22-8-10-3-2-6-21-10/h2-7H,8H2,1H3 |
| InChIKey | XQJCKHIPQKKQGG-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |