C18H28N2O6S2 — CID 21005304
4-(4,4-dimethyl-1,1,3-trioxo-1,2-thiazolidin-2-yl)-2-methyl-N-(3-propan-2-yloxypropyl)benzenesulfonamide (PubChem CID 21005304) has the molecular formula C18H28N2O6S2 and a molecular weight of 432.56 g/mol. Its IUPAC name is 4-(4,4-dimethyl-1,1,3-trioxo-1,2-thiazolidin-2-yl)-2-methyl-N-(3-propan-2-yloxypropyl)benzenesulfonamide.
| Compound Name | 4-(4,4-dimethyl-1,1,3-trioxo-1,2-thiazolidin-2-yl)-2-methyl-N-(3-propan-2-yloxypropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 21005304 |
| Molecular Formula | C18H28N2O6S2 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | 4-(4,4-dimethyl-1,1,3-trioxo-1,2-thiazolidin-2-yl)-2-methyl-N-(3-propan-2-yloxypropyl)benzenesulfonamide |
| SMILES | Cc1cc(N2C(=O)C(C)(C)CS2(=O)=O)ccc1S(=O)(=O)NCCCOC(C)C |
| InChI | InChI=1S/C18H28N2O6S2/c1-13(2)26-10-6-9-19-28(24,25)16-8-7-15(11-14(16)3)20-17(21)18(4,5)12-27(20,22)23/h7-8,11,13,19H,6,9-10,12H2,1-5H3 |
| InChIKey | WCMLGYAOEHOROM-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|