C20H21N3O6S3 — CID 21005386
4-(4,4-dimethyl-1,1,3-trioxo-1,2-thiazolidin-2-yl)-N-(6-methoxy-1,3-benzothiazol-2-yl)-2-methylbenzenesulfonamide (PubChem CID 21005386) has the molecular formula C20H21N3O6S3 and a molecular weight of 495.60 g/mol. Its IUPAC name is 4-(4,4-dimethyl-1,1,3-trioxo-1,2-thiazolidin-2-yl)-N-(6-methoxy-1,3-benzothiazol-2-yl)-2-methylbenzenesulfonamide.
| Compound Name | 4-(4,4-dimethyl-1,1,3-trioxo-1,2-thiazolidin-2-yl)-N-(6-methoxy-1,3-benzothiazol-2-yl)-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 21005386 |
| Molecular Formula | C20H21N3O6S3 |
| Molecular Weight | 495.60 g/mol |
| Exact Mass | 495.06 |
| IUPAC Name | 4-(4,4-dimethyl-1,1,3-trioxo-1,2-thiazolidin-2-yl)-N-(6-methoxy-1,3-benzothiazol-2-yl)-2-methylbenzenesulfonamide |
| SMILES | COc1ccc2nc(NS(=O)(=O)c3ccc(N4C(=O)C(C)(C)CS4(=O)=O)cc3C)sc2c1 |
| InChI | InChI=1S/C20H21N3O6S3/c1-12-9-13(23-18(24)20(2,3)11-31(23,25)26)5-8-17(12)32(27,28)22-19-21-15-7-6-14(29-4)10-16(15)30-19/h5-10H,11H2,1-4H3,(H,21,22) |
| InChIKey | JHRPNXJJNIFHQP-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 122.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.60 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |