C19H19N3O4 — CID 21008849
ethyl 4-[2-(1H-benzimidazol-2-ylmethylamino)-2-oxoethoxy]benzoate (PubChem CID 21008849) has the molecular formula C19H19N3O4 and a molecular weight of 353.38 g/mol. Its IUPAC name is ethyl 4-[2-(1H-benzimidazol-2-ylmethylamino)-2-oxoethoxy]benzoate.
| Compound Name | ethyl 4-[2-(1H-benzimidazol-2-ylmethylamino)-2-oxoethoxy]benzoate |
|---|---|
| PubChem CID | 21008849 |
| Molecular Formula | C19H19N3O4 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | ethyl 4-[2-(1H-benzimidazol-2-ylmethylamino)-2-oxoethoxy]benzoate |
| SMILES | CCOC(=O)c1ccc(OCC(=O)NCc2nc3ccccc3[nH]2)cc1 |
| InChI | InChI=1S/C19H19N3O4/c1-2-25-19(24)13-7-9-14(10-8-13)26-12-18(23)20-11-17-21-15-5-3-4-6-16(15)22-17/h3-10H,2,11-12H2,1H3,(H,20,23)(H,21,22) |
| InChIKey | NCCJJWUJSAHIBN-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 93.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |